C28H35N7O6 — CID 54479948
2-[(3S)-3-acetyl-4-[[4-(2-aminoethyl)benzoyl]amino]-3-[3-[(4-carbamimidoylbenzoyl)amino]propyl]-2-oxopiperazin-1-yl]acetic acid (PubChem CID 54479948) has the molecular formula C28H35N7O6 and a molecular weight of 565.63 g/mol. Its IUPAC name is 2-[(3S)-3-acetyl-4-[[4-(2-aminoethyl)benzoyl]amino]-3-[3-[(4-carbamimidoylbenzoyl)amino]propyl]-2-oxopiperazin-1-yl]acetic acid.
| Compound Name | 2-[(3S)-3-acetyl-4-[[4-(2-aminoethyl)benzoyl]amino]-3-[3-[(4-carbamimidoylbenzoyl)amino]propyl]-2-oxopiperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 54479948 |
| Molecular Formula | C28H35N7O6 |
| Molecular Weight | 565.63 g/mol |
| Exact Mass | 565.26 |
| IUPAC Name | 2-[(3S)-3-acetyl-4-[[4-(2-aminoethyl)benzoyl]amino]-3-[3-[(4-carbamimidoylbenzoyl)amino]propyl]-2-oxopiperazin-1-yl]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)NCCC[C@]2(C(C)=O)C(=O)N(CC(=O)O)CCN2NC(=O)c2ccc(CCN)cc2)cc1 |
| InChI | InChI=1S/C28H35N7O6/c1-18(36)28(12-2-14-32-25(39)21-9-7-20(8-10-21)24(30)31)27(41)34(17-23(37)38)15-16-35(28)33-26(40)22-5-3-19(4-6-22)11-13-29/h3-10H,2,11-17,29H2,1H3,(H3,30,31)(H,32,39)(H,33,40)(H,37,38)/t28-/m0/s1 |
| InChIKey | XOHMEBOQYVRDLS-NDEPHWFRSA-N |
| XLogP | -0.12 |
| TPSA | 212.01 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.63 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|