C19H25N5O6 — CID 54241269
2-[(3S)-4-[2-[[4-(2-aminoethyl)benzoyl]amino]acetyl]-3-carbamoyl-3-methyl-2-oxopiperazin-1-yl]acetic acid (PubChem CID 54241269) has the molecular formula C19H25N5O6 and a molecular weight of 419.44 g/mol. Its IUPAC name is 2-[(3S)-4-[2-[[4-(2-aminoethyl)benzoyl]amino]acetyl]-3-carbamoyl-3-methyl-2-oxopiperazin-1-yl]acetic acid.
| Compound Name | 2-[(3S)-4-[2-[[4-(2-aminoethyl)benzoyl]amino]acetyl]-3-carbamoyl-3-methyl-2-oxopiperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 54241269 |
| Molecular Formula | C19H25N5O6 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 2-[(3S)-4-[2-[[4-(2-aminoethyl)benzoyl]amino]acetyl]-3-carbamoyl-3-methyl-2-oxopiperazin-1-yl]acetic acid |
| SMILES | C[C@]1(C(N)=O)C(=O)N(CC(=O)O)CCN1C(=O)CNC(=O)c1ccc(CCN)cc1 |
| InChI | InChI=1S/C19H25N5O6/c1-19(17(21)29)18(30)23(11-15(26)27)8-9-24(19)14(25)10-22-16(28)13-4-2-12(3-5-13)6-7-20/h2-5H,6-11,20H2,1H3,(H2,21,29)(H,22,28)(H,26,27)/t19-/m0/s1 |
| InChIKey | QQECNUZZPRWYPJ-IBGZPJMESA-N |
| XLogP | -2.08 |
| TPSA | 176.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|