C27H32N8O6 — CID 70048387
2-[(3R)-3-acetyl-4-[(4-carbamimidoylbenzoyl)amino]-3-[3-[(4-carbamimidoylbenzoyl)amino]propyl]-2-oxopiperazin-1-yl]acetic acid (PubChem CID 70048387) has the molecular formula C27H32N8O6 and a molecular weight of 564.60 g/mol. Its IUPAC name is 2-[(3R)-3-acetyl-4-[(4-carbamimidoylbenzoyl)amino]-3-[3-[(4-carbamimidoylbenzoyl)amino]propyl]-2-oxopiperazin-1-yl]acetic acid.
| Compound Name | 2-[(3R)-3-acetyl-4-[(4-carbamimidoylbenzoyl)amino]-3-[3-[(4-carbamimidoylbenzoyl)amino]propyl]-2-oxopiperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 70048387 |
| Molecular Formula | C27H32N8O6 |
| Molecular Weight | 564.60 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | 2-[(3R)-3-acetyl-4-[(4-carbamimidoylbenzoyl)amino]-3-[3-[(4-carbamimidoylbenzoyl)amino]propyl]-2-oxopiperazin-1-yl]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)NCCC[C@@]2(C(C)=O)C(=O)N(CC(=O)O)CCN2NC(=O)c2ccc(/C(N)=N/[H])cc2)cc1 |
| InChI | InChI=1S/C27H32N8O6/c1-16(36)27(11-2-12-32-24(39)19-7-3-17(4-8-19)22(28)29)26(41)34(15-21(37)38)13-14-35(27)33-25(40)20-9-5-18(6-10-20)23(30)31/h3-10H,2,11-15H2,1H3,(H3,28,29)(H3,30,31)(H,32,39)(H,33,40)(H,37,38)/t27-/m1/s1 |
| InChIKey | BBAVYPRVZNBDKS-HHHXNRCGSA-N |
| XLogP | -0.33 |
| TPSA | 235.86 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.60 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|