About 1-(3-isocyanatopropylsulfanyl)-2,4-dimethylbenzene
1-(3-isocyanatopropylsulfanyl)-2,4-dimethylbenzene (PubChem CID 54053146) has the molecular formula C12H15NOS
and a molecular weight of 221.32 g/mol. Its IUPAC name is 1-(3-isocyanatopropylsulfanyl)-2,4-dimethylbenzene.
Molecular Properties
| Compound Name | 1-(3-isocyanatopropylsulfanyl)-2,4-dimethylbenzene |
| PubChem CID | 54053146 |
| Molecular Formula | C12H15NOS |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 1-(3-isocyanatopropylsulfanyl)-2,4-dimethylbenzene |
| SMILES | Cc1ccc(SCCCN=C=O)c(C)c1 |
| InChI | InChI=1S/C12H15NOS/c1-10-4-5-12(11(2)8-10)15-7-3-6-13-9-14/h4-5,8H,3,6-7H2,1-2H3 |
| InChIKey | LUJCCYSWAVPHDP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-isocyanatopropylsulfanyl)-2,4-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-isocyanatopropylsulfanyl)-2,4-dimethylbenzene?
The IUPAC name of 1-(3-isocyanatopropylsulfanyl)-2,4-dimethylbenzene (CID 54053146) is 1-(3-isocyanatopropylsulfanyl)-2,4-dimethylbenzene.
What is the SMILES notation for 1-(3-isocyanatopropylsulfanyl)-2,4-dimethylbenzene?
The canonical SMILES for 1-(3-isocyanatopropylsulfanyl)-2,4-dimethylbenzene is Cc1ccc(SCCCN=C=O)c(C)c1.
What is the InChIKey of 1-(3-isocyanatopropylsulfanyl)-2,4-dimethylbenzene?
The InChIKey is LUJCCYSWAVPHDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NOS/c1-10-4-5-12(11(2)8-10)15-7-3-6-13-9-14/h4-5,8H,3,6-7H2,1-2H3.
What are the key properties of 1-(3-isocyanatopropylsulfanyl)-2,4-dimethylbenzene?
1-(3-isocyanatopropylsulfanyl)-2,4-dimethylbenzene has a molecular weight of 221.32 g/mol, XLogP of 3.12, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-isocyanatopropylsulfanyl)-2,4-dimethylbenzene is sourced from PubChem (CID 54053146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).