C12H15NOS — CID 54053146
1-(3-isocyanatopropylsulfanyl)-2,4-dimethylbenzene (PubChem CID 54053146) has the molecular formula C12H15NOS and a molecular weight of 221.32 g/mol. Its IUPAC name is 1-(3-isocyanatopropylsulfanyl)-2,4-dimethylbenzene.
| Compound Name | 1-(3-isocyanatopropylsulfanyl)-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 54053146 |
| Molecular Formula | C12H15NOS |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 1-(3-isocyanatopropylsulfanyl)-2,4-dimethylbenzene |
| SMILES | Cc1ccc(SCCCN=C=O)c(C)c1 |
| InChI | InChI=1S/C12H15NOS/c1-10-4-5-12(11(2)8-10)15-7-3-6-13-9-14/h4-5,8H,3,6-7H2,1-2H3 |
| InChIKey | LUJCCYSWAVPHDP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|