C20H29N3O7 — CID 54056022
[2-ethyl-2-(methoxymethyl)butyl] N-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-ethynyl-2-oxopyrimidin-4-yl]carbamate (PubChem CID 54056022) has the molecular formula C20H29N3O7 and a molecular weight of 423.47 g/mol. Its IUPAC name is [2-ethyl-2-(methoxymethyl)butyl] N-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-ethynyl-2-oxopyrimidin-4-yl]carbamate.
| Compound Name | [2-ethyl-2-(methoxymethyl)butyl] N-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-ethynyl-2-oxopyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 54056022 |
| Molecular Formula | C20H29N3O7 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | [2-ethyl-2-(methoxymethyl)butyl] N-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-ethynyl-2-oxopyrimidin-4-yl]carbamate |
| SMILES | C#Cc1cn([C@@H]2O[C@H](C)[C@@H](O)[C@H]2O)c(=O)nc1NC(=O)OCC(CC)(CC)COC |
| InChI | InChI=1S/C20H29N3O7/c1-6-13-9-23(17-15(25)14(24)12(4)30-17)18(26)21-16(13)22-19(27)29-11-20(7-2,8-3)10-28-5/h1,9,12,14-15,17,24-25H,7-8,10-11H2,2-5H3,(H,21,22,26,27)/t12-,14-,15-,17-/m1/s1 |
| InChIKey | LWHUHDKBNFELIJ-DNNBLBMLSA-N |
| XLogP | 0.87 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|