C20H29N3O6 — CID 57216826
octan-2-yl N-[1-[(2R,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-ethynyl-2-oxopyrimidin-4-yl]carbamate (PubChem CID 57216826) has the molecular formula C20H29N3O6 and a molecular weight of 407.47 g/mol. Its IUPAC name is octan-2-yl N-[1-[(2R,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-ethynyl-2-oxopyrimidin-4-yl]carbamate.
| Compound Name | octan-2-yl N-[1-[(2R,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-ethynyl-2-oxopyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 57216826 |
| Molecular Formula | C20H29N3O6 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | octan-2-yl N-[1-[(2R,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-ethynyl-2-oxopyrimidin-4-yl]carbamate |
| SMILES | C#Cc1cn([C@@H]2O[C@H](C)C(O)C2O)c(=O)nc1NC(=O)OC(C)CCCCCC |
| InChI | InChI=1S/C20H29N3O6/c1-5-7-8-9-10-12(3)28-20(27)22-17-14(6-2)11-23(19(26)21-17)18-16(25)15(24)13(4)29-18/h2,11-13,15-16,18,24-25H,5,7-10H2,1,3-4H3,(H,21,22,26,27)/t12?,13-,15?,16?,18-/m1/s1 |
| InChIKey | SJDWQJLATWEEPF-QVWKRCNBSA-N |
| XLogP | 1.77 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|