C13H14ClN — CID 54056378
1-(4-chlorophenyl)-N,N-dimethylpent-1-en-4-yn-3-amine (PubChem CID 54056378) has the molecular formula C13H14ClN and a molecular weight of 219.72 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N,N-dimethylpent-1-en-4-yn-3-amine.
| Compound Name | 1-(4-chlorophenyl)-N,N-dimethylpent-1-en-4-yn-3-amine |
|---|---|
| PubChem CID | 54056378 |
| Molecular Formula | C13H14ClN |
| Molecular Weight | 219.72 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 1-(4-chlorophenyl)-N,N-dimethylpent-1-en-4-yn-3-amine |
| SMILES | C#CC(C=Cc1ccc(Cl)cc1)N(C)C |
| InChI | InChI=1S/C13H14ClN/c1-4-13(15(2)3)10-7-11-5-8-12(14)9-6-11/h1,5-10,13H,2-3H3 |
| InChIKey | LWODDQIWJSOBFR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.72 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|