C30H29N7O3S — CID 54057660
butyl 2-[[5-ethyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,3,4-thiadiazol-2-ylidene]carbamoyl]benzoate (PubChem CID 54057660) has the molecular formula C30H29N7O3S and a molecular weight of 567.68 g/mol. Its IUPAC name is butyl 2-[[5-ethyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,3,4-thiadiazol-2-ylidene]carbamoyl]benzoate.
| Compound Name | butyl 2-[[5-ethyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,3,4-thiadiazol-2-ylidene]carbamoyl]benzoate |
|---|---|
| PubChem CID | 54057660 |
| Molecular Formula | C30H29N7O3S |
| Molecular Weight | 567.68 g/mol |
| Exact Mass | 567.21 |
| IUPAC Name | butyl 2-[[5-ethyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,3,4-thiadiazol-2-ylidene]carbamoyl]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1C(=O)/N=c1\sc(CC)nn1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C30H29N7O3S/c1-3-5-18-40-29(39)25-13-9-8-12-24(25)28(38)31-30-37(34-26(4-2)41-30)19-20-14-16-21(17-15-20)22-10-6-7-11-23(22)27-32-35-36-33-27/h6-17H,3-5,18-19H2,1-2H3,(H,32,33,35,36)/b31-30- |
| InChIKey | LXKATXRYERSHLP-KTMFPKCZSA-N |
| XLogP | 5.10 |
| TPSA | 128.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.68 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|