C32H32N6O3S — CID 139663833
ethyl 2-benzoylimino-5-pentyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,3-thiazole-4-carboxylate (PubChem CID 139663833) has the molecular formula C32H32N6O3S and a molecular weight of 580.71 g/mol. Its IUPAC name is ethyl 2-benzoylimino-5-pentyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-benzoylimino-5-pentyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 139663833 |
| Molecular Formula | C32H32N6O3S |
| Molecular Weight | 580.71 g/mol |
| Exact Mass | 580.23 |
| IUPAC Name | ethyl 2-benzoylimino-5-pentyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCCCCc1s/c(=N\C(=O)c2ccccc2)n(Cc2ccc(-c3ccccc3-c3nn[nH]n3)cc2)c1C(=O)OCC |
| InChI | InChI=1S/C32H32N6O3S/c1-3-5-7-16-27-28(31(40)41-4-2)38(32(42-27)33-30(39)24-12-8-6-9-13-24)21-22-17-19-23(20-18-22)25-14-10-11-15-26(25)29-34-36-37-35-29/h6,8-15,17-20H,3-5,7,16,21H2,1-2H3,(H,34,35,36,37)/b33-32- |
| InChIKey | AVLRQWUXHFFADG-KARKAFJISA-N |
| XLogP | 6.10 |
| TPSA | 115.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.71 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|