C25H23K2N7O3S — CID 68920920
CID 68920920 (PubChem CID 68920920) has the molecular formula C25H23K2N7O3S and a molecular weight of 579.77 g/mol.
| Compound Name | CID 68920920 |
|---|---|
| PubChem CID | 68920920 |
| Molecular Formula | C25H23K2N7O3S |
| Molecular Weight | 579.77 g/mol |
| Exact Mass | 579.09 |
| IUPAC Name | — |
| SMILES | CCc1nn(Cc2ccc(-c3ccccc3-c3nn[nH]n3)cc2)/c(=N/C(=O)C2=C(C(=O)O)CCC2)s1.[K].[K] |
| InChI | InChI=1S/C25H23N7O3S.2K/c1-2-21-29-32(25(36-21)26-23(33)19-8-5-9-20(19)24(34)35)14-15-10-12-16(13-11-15)17-6-3-4-7-18(17)22-27-30-31-28-22;;/h3-4,6-7,10-13H,2,5,8-9,14H2,1H3,(H,34,35)(H,27,28,30,31);;/b26-25-;; |
| InChIKey | NBHYLPIWXXIVTG-IEZULETDSA-N |
| XLogP | 2.63 |
| TPSA | 139.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.77 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |