C24H24ClNO — CID 54060641
1-(4-chlorophenyl)-2-methyl-N-[(2-methyl-3-phenylphenyl)methoxy]prop-1-en-1-amine (PubChem CID 54060641) has the molecular formula C24H24ClNO and a molecular weight of 377.92 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-methyl-N-[(2-methyl-3-phenylphenyl)methoxy]prop-1-en-1-amine.
| Compound Name | 1-(4-chlorophenyl)-2-methyl-N-[(2-methyl-3-phenylphenyl)methoxy]prop-1-en-1-amine |
|---|---|
| PubChem CID | 54060641 |
| Molecular Formula | C24H24ClNO |
| Molecular Weight | 377.92 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 1-(4-chlorophenyl)-2-methyl-N-[(2-methyl-3-phenylphenyl)methoxy]prop-1-en-1-amine |
| SMILES | CC(C)=C(NOCc1cccc(-c2ccccc2)c1C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H24ClNO/c1-17(2)24(20-12-14-22(25)15-13-20)26-27-16-21-10-7-11-23(18(21)3)19-8-5-4-6-9-19/h4-15,26H,16H2,1-3H3 |
| InChIKey | LZLJLFRJQQYSGM-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.92 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|