C17H24O5 — CID 54061352
3-methyl-5-[(6'R)-2',2',6'-trimethylspiro[1,3-dioxolane-2,4'-7-oxabicyclo[4.1.0]heptane]-1'-yl]penta-2,4-dienoic acid (PubChem CID 54061352) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is 3-methyl-5-[(6'R)-2',2',6'-trimethylspiro[1,3-dioxolane-2,4'-7-oxabicyclo[4.1.0]heptane]-1'-yl]penta-2,4-dienoic acid.
| Compound Name | 3-methyl-5-[(6'R)-2',2',6'-trimethylspiro[1,3-dioxolane-2,4'-7-oxabicyclo[4.1.0]heptane]-1'-yl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 54061352 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 3-methyl-5-[(6'R)-2',2',6'-trimethylspiro[1,3-dioxolane-2,4'-7-oxabicyclo[4.1.0]heptane]-1'-yl]penta-2,4-dienoic acid |
| SMILES | CC(C=CC12O[C@]1(C)CC1(CC2(C)C)OCCO1)=CC(=O)O |
| InChI | InChI=1S/C17H24O5/c1-12(9-13(18)19)5-6-17-14(2,3)10-16(20-7-8-21-16)11-15(17,4)22-17/h5-6,9H,7-8,10-11H2,1-4H3,(H,18,19)/t15-,17?/m1/s1 |
| InChIKey | LZYDVFICVAEVBT-LDCVWXEPSA-N |
| XLogP | 2.66 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|