About 2-(methylamino)ethyl 3-iminobutanoate
2-(methylamino)ethyl 3-iminobutanoate (PubChem CID 54061790) has the molecular formula C7H14N2O2
and a molecular weight of 158.20 g/mol. Its IUPAC name is 2-(methylamino)ethyl 3-iminobutanoate.
Molecular Properties
| Compound Name | 2-(methylamino)ethyl 3-iminobutanoate |
| PubChem CID | 54061790 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 2-(methylamino)ethyl 3-iminobutanoate |
| SMILES | [H]/N=C(\C)CC(=O)OCCNC |
| InChI | InChI=1S/C7H14N2O2/c1-6(8)5-7(10)11-4-3-9-2/h8-9H,3-5H2,1-2H3/b8-6+ |
| InChIKey | MAFWOUBSTDWSDE-SOFGYWHQSA-N |
| XLogP | 0.18 |
| TPSA | 62.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(methylamino)ethyl 3-iminobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methylamino)ethyl 3-iminobutanoate?
The IUPAC name of 2-(methylamino)ethyl 3-iminobutanoate (CID 54061790) is 2-(methylamino)ethyl 3-iminobutanoate.
What is the SMILES notation for 2-(methylamino)ethyl 3-iminobutanoate?
The canonical SMILES for 2-(methylamino)ethyl 3-iminobutanoate is [H]/N=C(\C)CC(=O)OCCNC.
What is the InChIKey of 2-(methylamino)ethyl 3-iminobutanoate?
The InChIKey is MAFWOUBSTDWSDE-SOFGYWHQSA-N. The full InChI is InChI=1S/C7H14N2O2/c1-6(8)5-7(10)11-4-3-9-2/h8-9H,3-5H2,1-2H3/b8-6+.
What are the key properties of 2-(methylamino)ethyl 3-iminobutanoate?
2-(methylamino)ethyl 3-iminobutanoate has a molecular weight of 158.20 g/mol, XLogP of 0.18, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methylamino)ethyl 3-iminobutanoate is sourced from PubChem (CID 54061790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).