C25H19ClN2O2 — CID 54063603
N-[(4-chlorophenyl)methyl]-8-hydroxy-2-(2-phenylethenyl)quinoline-7-carboxamide (PubChem CID 54063603) has the molecular formula C25H19ClN2O2 and a molecular weight of 414.89 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-8-hydroxy-2-(2-phenylethenyl)quinoline-7-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-8-hydroxy-2-(2-phenylethenyl)quinoline-7-carboxamide |
|---|---|
| PubChem CID | 54063603 |
| Molecular Formula | C25H19ClN2O2 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-8-hydroxy-2-(2-phenylethenyl)quinoline-7-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)c1ccc2ccc(C=Cc3ccccc3)nc2c1O |
| InChI | InChI=1S/C25H19ClN2O2/c26-20-11-6-18(7-12-20)16-27-25(30)22-15-10-19-9-14-21(28-23(19)24(22)29)13-8-17-4-2-1-3-5-17/h1-15,29H,16H2,(H,27,30) |
| InChIKey | MBKXGQUAOCSQLS-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |