C21H20O4S — CID 54066028
ethyl 4-oxo-3-propyl-2-(2-thiophen-2-ylethenyl)chromene-6-carboxylate (PubChem CID 54066028) has the molecular formula C21H20O4S and a molecular weight of 368.45 g/mol. Its IUPAC name is ethyl 4-oxo-3-propyl-2-(2-thiophen-2-ylethenyl)chromene-6-carboxylate.
| Compound Name | ethyl 4-oxo-3-propyl-2-(2-thiophen-2-ylethenyl)chromene-6-carboxylate |
|---|---|
| PubChem CID | 54066028 |
| Molecular Formula | C21H20O4S |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | ethyl 4-oxo-3-propyl-2-(2-thiophen-2-ylethenyl)chromene-6-carboxylate |
| SMILES | CCCc1c(C=Cc2cccs2)oc2ccc(C(=O)OCC)cc2c1=O |
| InChI | InChI=1S/C21H20O4S/c1-3-6-16-18(11-9-15-7-5-12-26-15)25-19-10-8-14(21(23)24-4-2)13-17(19)20(16)22/h5,7-13H,3-4,6H2,1-2H3 |
| InChIKey | MDAVCBHJKNSFGN-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |