C19H21NO4 — CID 54072573
[2-[(2,3-dimethylphenoxy)methyl]phenyl] 2-methoxyiminopropanoate (PubChem CID 54072573) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is [2-[(2,3-dimethylphenoxy)methyl]phenyl] 2-methoxyiminopropanoate.
| Compound Name | [2-[(2,3-dimethylphenoxy)methyl]phenyl] 2-methoxyiminopropanoate |
|---|---|
| PubChem CID | 54072573 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | [2-[(2,3-dimethylphenoxy)methyl]phenyl] 2-methoxyiminopropanoate |
| SMILES | CON=C(C)C(=O)Oc1ccccc1COc1cccc(C)c1C |
| InChI | InChI=1S/C19H21NO4/c1-13-8-7-11-17(14(13)2)23-12-16-9-5-6-10-18(16)24-19(21)15(3)20-22-4/h5-11H,12H2,1-4H3 |
| InChIKey | MHMBUJOZDBQSOK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|