C31H60N4O2 — CID 54072688
5-cyclopentyl-5-methyl-1,3-bis[[methyl(nonyl)amino]methyl]imidazolidine-2,4-dione (PubChem CID 54072688) has the molecular formula C31H60N4O2 and a molecular weight of 520.85 g/mol. Its IUPAC name is 5-cyclopentyl-5-methyl-1,3-bis[[methyl(nonyl)amino]methyl]imidazolidine-2,4-dione.
| Compound Name | 5-cyclopentyl-5-methyl-1,3-bis[[methyl(nonyl)amino]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 54072688 |
| Molecular Formula | C31H60N4O2 |
| Molecular Weight | 520.85 g/mol |
| Exact Mass | 520.47 |
| IUPAC Name | 5-cyclopentyl-5-methyl-1,3-bis[[methyl(nonyl)amino]methyl]imidazolidine-2,4-dione |
| SMILES | CCCCCCCCCN(C)CN1C(=O)N(CN(C)CCCCCCCCC)C(C)(C2CCCC2)C1=O |
| InChI | InChI=1S/C31H60N4O2/c1-6-8-10-12-14-16-20-24-32(4)26-34-29(36)31(3,28-22-18-19-23-28)35(30(34)37)27-33(5)25-21-17-15-13-11-9-7-2/h28H,6-27H2,1-5H3 |
| InChIKey | MHOQXERECWKVLP-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.85 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|