C31H57N3O3 — CID 70596059
3-[[methyl(octyl)amino]methyl]-5-octadec-9-enoylimidazolidine-2,4-dione (PubChem CID 70596059) has the molecular formula C31H57N3O3 and a molecular weight of 519.82 g/mol. Its IUPAC name is 3-[[methyl(octyl)amino]methyl]-5-octadec-9-enoylimidazolidine-2,4-dione.
| Compound Name | 3-[[methyl(octyl)amino]methyl]-5-octadec-9-enoylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 70596059 |
| Molecular Formula | C31H57N3O3 |
| Molecular Weight | 519.82 g/mol |
| Exact Mass | 519.44 |
| IUPAC Name | 3-[[methyl(octyl)amino]methyl]-5-octadec-9-enoylimidazolidine-2,4-dione |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)C1NC(=O)N(CN(C)CCCCCCCC)C1=O |
| InChI | InChI=1S/C31H57N3O3/c1-4-6-8-10-12-13-14-15-16-17-18-19-20-21-23-25-28(35)29-30(36)34(31(37)32-29)27-33(3)26-24-22-11-9-7-5-2/h15-16,29H,4-14,17-27H2,1-3H3,(H,32,37) |
| InChIKey | KJXSNHJSMYZFFN-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.82 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|