C18H25N3O3 — CID 144688670
5-cyclopentyl-3-[2-(1,2-dihydropyridin-5-yl)-2-oxoethyl]-1-ethyl-5-methylimidazolidine-2,4-dione (PubChem CID 144688670) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is 5-cyclopentyl-3-[2-(1,2-dihydropyridin-5-yl)-2-oxoethyl]-1-ethyl-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-cyclopentyl-3-[2-(1,2-dihydropyridin-5-yl)-2-oxoethyl]-1-ethyl-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 144688670 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 5-cyclopentyl-3-[2-(1,2-dihydropyridin-5-yl)-2-oxoethyl]-1-ethyl-5-methylimidazolidine-2,4-dione |
| SMILES | CCN1C(=O)N(CC(=O)C2=CNCC=C2)C(=O)C1(C)C1CCCC1 |
| InChI | InChI=1S/C18H25N3O3/c1-3-21-17(24)20(12-15(22)13-7-6-10-19-11-13)16(23)18(21,2)14-8-4-5-9-14/h6-7,11,14,19H,3-5,8-10,12H2,1-2H3 |
| InChIKey | GZVKQFCGKANZSP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|