C20H28N2O3 — CID 138510220
5-cyclohexyl-3-[(3E)-3-ethenyl-2-oxohexa-3,5-dienyl]-1,5-dimethyl-1,3-diazinane-2,4-dione (PubChem CID 138510220) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is 5-cyclohexyl-3-[(3E)-3-ethenyl-2-oxohexa-3,5-dienyl]-1,5-dimethyl-1,3-diazinane-2,4-dione.
| Compound Name | 5-cyclohexyl-3-[(3E)-3-ethenyl-2-oxohexa-3,5-dienyl]-1,5-dimethyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 138510220 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 5-cyclohexyl-3-[(3E)-3-ethenyl-2-oxohexa-3,5-dienyl]-1,5-dimethyl-1,3-diazinane-2,4-dione |
| SMILES | C=C/C=C(\C=C)C(=O)CN1C(=O)N(C)CC(C)(C2CCCCC2)C1=O |
| InChI | InChI=1S/C20H28N2O3/c1-5-10-15(6-2)17(23)13-22-18(24)20(3,14-21(4)19(22)25)16-11-8-7-9-12-16/h5-6,10,16H,1-2,7-9,11-14H2,3-4H3/b15-10+ |
| InChIKey | GCDOCIFGLYWJJK-XNTDXEJSSA-N |
| XLogP | 3.33 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|