C11H10N2O2 — CID 54072690
3,5-dihydroxy-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-triene-4-carbonitrile (PubChem CID 54072690) has the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. Its IUPAC name is 3,5-dihydroxy-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-triene-4-carbonitrile.
| Compound Name | 3,5-dihydroxy-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-triene-4-carbonitrile |
|---|---|
| PubChem CID | 54072690 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 3,5-dihydroxy-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-triene-4-carbonitrile |
| SMILES | N#Cn1c(O)c2c(c1O)C1C=CC2CC1 |
| InChI | InChI=1S/C11H10N2O2/c12-5-13-10(14)8-6-1-2-7(4-3-6)9(8)11(13)15/h1-2,6-7,14-15H,3-4H2 |
| InChIKey | MHOSWCDBOCMUMW-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|