C9H9N5OS — CID 54074101
N-[3-(2H-tetrazol-5-ylsulfanyl)phenyl]acetamide (PubChem CID 54074101) has the molecular formula C9H9N5OS and a molecular weight of 235.27 g/mol. Its IUPAC name is N-[3-(2H-tetrazol-5-ylsulfanyl)phenyl]acetamide.
| Compound Name | N-[3-(2H-tetrazol-5-ylsulfanyl)phenyl]acetamide |
|---|---|
| PubChem CID | 54074101 |
| Molecular Formula | C9H9N5OS |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | N-[3-(2H-tetrazol-5-ylsulfanyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(Sc2nn[nH]n2)c1 |
| InChI | InChI=1S/C9H9N5OS/c1-6(15)10-7-3-2-4-8(5-7)16-9-11-13-14-12-9/h2-5H,1H3,(H,10,15)(H,11,12,13,14) |
| InChIKey | MIMNASBFYLDTKP-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |