C24H29FN2O3 — CID 54074242
[1-[4-(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)butyl]piperidin-4-yl]-(4-fluorophenyl)methanone (PubChem CID 54074242) has the molecular formula C24H29FN2O3 and a molecular weight of 412.51 g/mol. Its IUPAC name is [1-[4-(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)butyl]piperidin-4-yl]-(4-fluorophenyl)methanone.
| Compound Name | [1-[4-(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)butyl]piperidin-4-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 54074242 |
| Molecular Formula | C24H29FN2O3 |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | [1-[4-(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)butyl]piperidin-4-yl]-(4-fluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)cc1)C1CCN(CCCCn2c(O)c3c(c2O)CC=CC3)CC1 |
| InChI | InChI=1S/C24H29FN2O3/c25-19-9-7-17(8-10-19)22(28)18-11-15-26(16-12-18)13-3-4-14-27-23(29)20-5-1-2-6-21(20)24(27)30/h1-2,7-10,18,29-30H,3-6,11-16H2 |
| InChIKey | MIOVPFJNOZTLQY-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 65.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|