C24H30O2 — CID 54074286
trans-(2R,5R)-2-methoxy-5-[4-(4-pentylphenyl)phenyl]cyclohexan-1-one (PubChem CID 54074286) has the molecular formula C24H30O2 and a molecular weight of 350.50 g/mol. Its IUPAC name is trans-(2R,5R)-2-methoxy-5-[4-(4-pentylphenyl)phenyl]cyclohexan-1-one.
| Compound Name | trans-(2R,5R)-2-methoxy-5-[4-(4-pentylphenyl)phenyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 54074286 |
| Molecular Formula | C24H30O2 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | trans-(2R,5R)-2-methoxy-5-[4-(4-pentylphenyl)phenyl]cyclohexan-1-one |
| SMILES | CCCCCc1ccc(-c2ccc([C@@H]3CC[C@@H](OC)C(=O)C3)cc2)cc1 |
| InChI | InChI=1S/C24H30O2/c1-3-4-5-6-18-7-9-19(10-8-18)20-11-13-21(14-12-20)22-15-16-24(26-2)23(25)17-22/h7-14,22,24H,3-6,15-17H2,1-2H3/t22-,24-/m1/s1 |
| InChIKey | MIPLUZHERHVKIN-ISKFKSNPSA-N |
| XLogP | 5.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|