C25H31NO5S2 — CID 54074927
2-[1-[5-(2-benzylideneoctylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butyl]propanedioic acid (PubChem CID 54074927) has the molecular formula C25H31NO5S2 and a molecular weight of 489.66 g/mol. Its IUPAC name is 2-[1-[5-(2-benzylideneoctylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butyl]propanedioic acid.
| Compound Name | 2-[1-[5-(2-benzylideneoctylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butyl]propanedioic acid |
|---|---|
| PubChem CID | 54074927 |
| Molecular Formula | C25H31NO5S2 |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | 2-[1-[5-(2-benzylideneoctylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butyl]propanedioic acid |
| SMILES | CCCCCCC(=Cc1ccccc1)C=C1SC(=S)N(C(CCC)C(C(=O)O)C(=O)O)C1=O |
| InChI | InChI=1S/C25H31NO5S2/c1-3-5-6-8-14-18(15-17-12-9-7-10-13-17)16-20-22(27)26(25(32)33-20)19(11-4-2)21(23(28)29)24(30)31/h7,9-10,12-13,15-16,19,21H,3-6,8,11,14H2,1-2H3,(H,28,29)(H,30,31) |
| InChIKey | MJABCEIQTROEPI-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|