C19H21NO5S2 — CID 54143666
2-[1-[5-[(2,5-dimethylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butyl]propanedioic acid (PubChem CID 54143666) has the molecular formula C19H21NO5S2 and a molecular weight of 407.51 g/mol. Its IUPAC name is 2-[1-[5-[(2,5-dimethylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butyl]propanedioic acid.
| Compound Name | 2-[1-[5-[(2,5-dimethylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butyl]propanedioic acid |
|---|---|
| PubChem CID | 54143666 |
| Molecular Formula | C19H21NO5S2 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 2-[1-[5-[(2,5-dimethylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butyl]propanedioic acid |
| SMILES | CCCC(C(C(=O)O)C(=O)O)N1C(=O)C(=Cc2cc(C)ccc2C)SC1=S |
| InChI | InChI=1S/C19H21NO5S2/c1-4-5-13(15(17(22)23)18(24)25)20-16(21)14(27-19(20)26)9-12-8-10(2)6-7-11(12)3/h6-9,13,15H,4-5H2,1-3H3,(H,22,23)(H,24,25) |
| InChIKey | OCVBQOJXSUAFFS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|