C21H20N2OS2 — CID 2935765
5-[(2,5-dimethylphenyl)methylidene]-3-[(2,5-dimethylphenyl)methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 2935765) has the molecular formula C21H20N2OS2 and a molecular weight of 380.54 g/mol. Its IUPAC name is 5-[(2,5-dimethylphenyl)methylidene]-3-[(2,5-dimethylphenyl)methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[(2,5-dimethylphenyl)methylidene]-3-[(2,5-dimethylphenyl)methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 2935765 |
| Molecular Formula | C21H20N2OS2 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 5-[(2,5-dimethylphenyl)methylidene]-3-[(2,5-dimethylphenyl)methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(C)c(C=NN2C(=O)C(=Cc3cc(C)ccc3C)SC2=S)c1 |
| InChI | InChI=1S/C21H20N2OS2/c1-13-5-7-15(3)17(9-13)11-19-20(24)23(21(25)26-19)22-12-18-10-14(2)6-8-16(18)4/h5-12H,1-4H3 |
| InChIKey | IOCQYJQKJCVAGS-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|