C30H35N3O9 — CID 54076506
[[4-[(3R)-4-[4-(2-ethoxy-2-oxoethoxy)piperidin-1-yl]-3-methyl-4-oxobutanoyl]phenyl]methylideneamino]carbamoyloxymethyl benzoate (PubChem CID 54076506) has the molecular formula C30H35N3O9 and a molecular weight of 581.62 g/mol. Its IUPAC name is [[4-[(3R)-4-[4-(2-ethoxy-2-oxoethoxy)piperidin-1-yl]-3-methyl-4-oxobutanoyl]phenyl]methylideneamino]carbamoyloxymethyl benzoate.
| Compound Name | [[4-[(3R)-4-[4-(2-ethoxy-2-oxoethoxy)piperidin-1-yl]-3-methyl-4-oxobutanoyl]phenyl]methylideneamino]carbamoyloxymethyl benzoate |
|---|---|
| PubChem CID | 54076506 |
| Molecular Formula | C30H35N3O9 |
| Molecular Weight | 581.62 g/mol |
| Exact Mass | 581.24 |
| IUPAC Name | [[4-[(3R)-4-[4-(2-ethoxy-2-oxoethoxy)piperidin-1-yl]-3-methyl-4-oxobutanoyl]phenyl]methylideneamino]carbamoyloxymethyl benzoate |
| SMILES | CCOC(=O)COC1CCN(C(=O)[C@H](C)CC(=O)c2ccc(C=NNC(=O)OCOC(=O)c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C30H35N3O9/c1-3-39-27(35)19-40-25-13-15-33(16-14-25)28(36)21(2)17-26(34)23-11-9-22(10-12-23)18-31-32-30(38)42-20-41-29(37)24-7-5-4-6-8-24/h4-12,18,21,25H,3,13-17,19-20H2,1-2H3,(H,32,38)/t21-/m1/s1 |
| InChIKey | MKBQNZJYCVTJPX-OAQYLSRUSA-N |
| XLogP | 3.34 |
| TPSA | 149.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.62 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|