C26H29N3O7 — CID 173315108
[[4-[4-(4-hydroxypiperidin-1-yl)-3-methyl-4-oxobutanoyl]phenyl]methylideneamino]carbamoyloxymethyl benzoate (PubChem CID 173315108) has the molecular formula C26H29N3O7 and a molecular weight of 495.53 g/mol. Its IUPAC name is [[4-[4-(4-hydroxypiperidin-1-yl)-3-methyl-4-oxobutanoyl]phenyl]methylideneamino]carbamoyloxymethyl benzoate.
| Compound Name | [[4-[4-(4-hydroxypiperidin-1-yl)-3-methyl-4-oxobutanoyl]phenyl]methylideneamino]carbamoyloxymethyl benzoate |
|---|---|
| PubChem CID | 173315108 |
| Molecular Formula | C26H29N3O7 |
| Molecular Weight | 495.53 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | [[4-[4-(4-hydroxypiperidin-1-yl)-3-methyl-4-oxobutanoyl]phenyl]methylideneamino]carbamoyloxymethyl benzoate |
| SMILES | CC(CC(=O)c1ccc(C=NNC(=O)OCOC(=O)c2ccccc2)cc1)C(=O)N1CCC(O)CC1 |
| InChI | InChI=1S/C26H29N3O7/c1-18(24(32)29-13-11-22(30)12-14-29)15-23(31)20-9-7-19(8-10-20)16-27-28-26(34)36-17-35-25(33)21-5-3-2-4-6-21/h2-10,16,18,22,30H,11-15,17H2,1H3,(H,28,34) |
| InChIKey | SEVXJTODCOFAHI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 134.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.53 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|