C29H33N3O2 — CID 54087118
(3R,4S)-1-(4-methoxyphenyl)-3-(3-phenylpropyl)-4-(4-piperazin-1-ylphenyl)azetidin-2-one (PubChem CID 54087118) has the molecular formula C29H33N3O2 and a molecular weight of 455.60 g/mol. Its IUPAC name is (3R,4S)-1-(4-methoxyphenyl)-3-(3-phenylpropyl)-4-(4-piperazin-1-ylphenyl)azetidin-2-one.
| Compound Name | (3R,4S)-1-(4-methoxyphenyl)-3-(3-phenylpropyl)-4-(4-piperazin-1-ylphenyl)azetidin-2-one |
|---|---|
| PubChem CID | 54087118 |
| Molecular Formula | C29H33N3O2 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | (3R,4S)-1-(4-methoxyphenyl)-3-(3-phenylpropyl)-4-(4-piperazin-1-ylphenyl)azetidin-2-one |
| SMILES | COc1ccc(N2C(=O)[C@H](CCCc3ccccc3)[C@H]2c2ccc(N3CCNCC3)cc2)cc1 |
| InChI | InChI=1S/C29H33N3O2/c1-34-26-16-14-25(15-17-26)32-28(23-10-12-24(13-11-23)31-20-18-30-19-21-31)27(29(32)33)9-5-8-22-6-3-2-4-7-22/h2-4,6-7,10-17,27-28,30H,5,8-9,18-21H2,1H3/t27-,28-/m1/s1 |
| InChIKey | MRGJQFKCGYOBFS-VSGBNLITSA-N |
| XLogP | 4.83 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|