C25H24INO3 — CID 101159877
(3S,4R)-4-(4-hydroxyphenyl)-3-[3-(4-iodophenyl)propyl]-1-(4-methoxyphenyl)azetidin-2-one (PubChem CID 101159877) has the molecular formula C25H24INO3 and a molecular weight of 513.38 g/mol. Its IUPAC name is (3S,4R)-4-(4-hydroxyphenyl)-3-[3-(4-iodophenyl)propyl]-1-(4-methoxyphenyl)azetidin-2-one.
| Compound Name | (3S,4R)-4-(4-hydroxyphenyl)-3-[3-(4-iodophenyl)propyl]-1-(4-methoxyphenyl)azetidin-2-one |
|---|---|
| PubChem CID | 101159877 |
| Molecular Formula | C25H24INO3 |
| Molecular Weight | 513.38 g/mol |
| Exact Mass | 513.08 |
| IUPAC Name | (3S,4R)-4-(4-hydroxyphenyl)-3-[3-(4-iodophenyl)propyl]-1-(4-methoxyphenyl)azetidin-2-one |
| SMILES | COc1ccc(N2C(=O)[C@@H](CCCc3ccc(I)cc3)[C@@H]2c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C25H24INO3/c1-30-22-15-11-20(12-16-22)27-24(18-7-13-21(28)14-8-18)23(25(27)29)4-2-3-17-5-9-19(26)10-6-17/h5-16,23-24,28H,2-4H2,1H3/t23-,24-/m0/s1 |
| InChIKey | PXABAPIJDXYYHP-ZEQRLZLVSA-N |
| XLogP | 5.73 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.38 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|