C18H20N4O4 — CID 54090774
4-[1-(2-aminoethyl)-6-oxopyridazin-3-yl]-3,3-dihydroxy-2,2-dimethyl-4H-chromene-6-carbonitrile (PubChem CID 54090774) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is 4-[1-(2-aminoethyl)-6-oxopyridazin-3-yl]-3,3-dihydroxy-2,2-dimethyl-4H-chromene-6-carbonitrile.
| Compound Name | 4-[1-(2-aminoethyl)-6-oxopyridazin-3-yl]-3,3-dihydroxy-2,2-dimethyl-4H-chromene-6-carbonitrile |
|---|---|
| PubChem CID | 54090774 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 4-[1-(2-aminoethyl)-6-oxopyridazin-3-yl]-3,3-dihydroxy-2,2-dimethyl-4H-chromene-6-carbonitrile |
| SMILES | CC1(C)Oc2ccc(C#N)cc2C(c2ccc(=O)n(CCN)n2)C1(O)O |
| InChI | InChI=1S/C18H20N4O4/c1-17(2)18(24,25)16(12-9-11(10-20)3-5-14(12)26-17)13-4-6-15(23)22(21-13)8-7-19/h3-6,9,16,24-25H,7-8,19H2,1-2H3 |
| InChIKey | MTRMLRKAOCLOFV-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 134.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|