C21H34O5 — CID 54095288
8-(4,5,6,7-tetramethoxy-2,3-dihydro-1H-inden-1-yl)octan-1-ol (PubChem CID 54095288) has the molecular formula C21H34O5 and a molecular weight of 366.50 g/mol. Its IUPAC name is 8-(4,5,6,7-tetramethoxy-2,3-dihydro-1H-inden-1-yl)octan-1-ol.
| Compound Name | 8-(4,5,6,7-tetramethoxy-2,3-dihydro-1H-inden-1-yl)octan-1-ol |
|---|---|
| PubChem CID | 54095288 |
| Molecular Formula | C21H34O5 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 8-(4,5,6,7-tetramethoxy-2,3-dihydro-1H-inden-1-yl)octan-1-ol |
| SMILES | COc1c2c(c(OC)c(OC)c1OC)C(CCCCCCCCO)CC2 |
| InChI | InChI=1S/C21H34O5/c1-23-18-16-13-12-15(11-9-7-5-6-8-10-14-22)17(16)19(24-2)21(26-4)20(18)25-3/h15,22H,5-14H2,1-4H3 |
| InChIKey | MWRGUUVVHRWVEB-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|