C24H28O6 — CID 102373586
7,8,9,14,15,16-hexamethoxypentacyclo[8.6.2.02,5.06,18.013,17]octadeca-1(16),6,8,10(18),13(17),14-hexaene (PubChem CID 102373586) has the molecular formula C24H28O6 and a molecular weight of 412.48 g/mol. Its IUPAC name is 7,8,9,14,15,16-hexamethoxypentacyclo[8.6.2.02,5.06,18.013,17]octadeca-1(16),6,8,10(18),13(17),14-hexaene.
| Compound Name | 7,8,9,14,15,16-hexamethoxypentacyclo[8.6.2.02,5.06,18.013,17]octadeca-1(16),6,8,10(18),13(17),14-hexaene |
|---|---|
| PubChem CID | 102373586 |
| Molecular Formula | C24H28O6 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 7,8,9,14,15,16-hexamethoxypentacyclo[8.6.2.02,5.06,18.013,17]octadeca-1(16),6,8,10(18),13(17),14-hexaene |
| SMILES | COc1c2c3c(c(OC)c1OC)C1CCC1c1c(OC)c(OC)c(OC)c(c1-3)CC2 |
| InChI | InChI=1S/C24H28O6/c1-25-19-13-9-10-14-16-15(13)17(21(27-3)23(19)29-5)11-7-8-12(11)18(16)22(28-4)24(30-6)20(14)26-2/h11-12H,7-10H2,1-6H3 |
| InChIKey | HAUNHKMZMFTALP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |