C29H25N3O7S — CID 54096359
benzhydryl (6R,7R)-7-[[2-(2-hydroxy-4-nitrophenyl)acetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 54096359) has the molecular formula C29H25N3O7S and a molecular weight of 559.60 g/mol. Its IUPAC name is benzhydryl (6R,7R)-7-[[2-(2-hydroxy-4-nitrophenyl)acetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (6R,7R)-7-[[2-(2-hydroxy-4-nitrophenyl)acetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 54096359 |
| Molecular Formula | C29H25N3O7S |
| Molecular Weight | 559.60 g/mol |
| Exact Mass | 559.14 |
| IUPAC Name | benzhydryl (6R,7R)-7-[[2-(2-hydroxy-4-nitrophenyl)acetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC1=C(C(=O)OC(c2ccccc2)c2ccccc2)N2C(=O)[C@@H](NC(=O)Cc3ccc([N+](=O)[O-])cc3O)[C@H]2SC1 |
| InChI | InChI=1S/C29H25N3O7S/c1-17-16-40-28-24(30-23(34)14-20-12-13-21(32(37)38)15-22(20)33)27(35)31(28)25(17)29(36)39-26(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-13,15,24,26,28,33H,14,16H2,1H3,(H,30,34)/t24-,28-/m1/s1 |
| InChIKey | MXJVDELVRUVLKJ-UFHPHHKVSA-N |
| XLogP | 3.85 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.60 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|