C14H13N3O2S2 — CID 54100593
2-methyl-N-(5-methyl-1,3-thiazol-2-yl)-4-oxo-3H-1,2-benzothiazine-3-carboxamide (PubChem CID 54100593) has the molecular formula C14H13N3O2S2 and a molecular weight of 319.41 g/mol. Its IUPAC name is 2-methyl-N-(5-methyl-1,3-thiazol-2-yl)-4-oxo-3H-1,2-benzothiazine-3-carboxamide.
| Compound Name | 2-methyl-N-(5-methyl-1,3-thiazol-2-yl)-4-oxo-3H-1,2-benzothiazine-3-carboxamide |
|---|---|
| PubChem CID | 54100593 |
| Molecular Formula | C14H13N3O2S2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 2-methyl-N-(5-methyl-1,3-thiazol-2-yl)-4-oxo-3H-1,2-benzothiazine-3-carboxamide |
| SMILES | Cc1cnc(NC(=O)C2C(=O)c3ccccc3SN2C)s1 |
| InChI | InChI=1S/C14H13N3O2S2/c1-8-7-15-14(20-8)16-13(19)11-12(18)9-5-3-4-6-10(9)21-17(11)2/h3-7,11H,1-2H3,(H,15,16,19) |
| InChIKey | NAGFOGPDTVCPHL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|