C14H12FN3O4S2 — CID 54132997
7-fluoro-2-methyl-N-(5-methyl-1,3-thiazol-2-yl)-1,1,4-trioxo-3H-1λ6,2-benzothiazine-3-carboxamide (PubChem CID 54132997) has the molecular formula C14H12FN3O4S2 and a molecular weight of 369.40 g/mol. Its IUPAC name is 7-fluoro-2-methyl-N-(5-methyl-1,3-thiazol-2-yl)-1,1,4-trioxo-3H-1λ6,2-benzothiazine-3-carboxamide.
| Compound Name | 7-fluoro-2-methyl-N-(5-methyl-1,3-thiazol-2-yl)-1,1,4-trioxo-3H-1λ6,2-benzothiazine-3-carboxamide |
|---|---|
| PubChem CID | 54132997 |
| Molecular Formula | C14H12FN3O4S2 |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | 7-fluoro-2-methyl-N-(5-methyl-1,3-thiazol-2-yl)-1,1,4-trioxo-3H-1λ6,2-benzothiazine-3-carboxamide |
| SMILES | Cc1cnc(NC(=O)C2C(=O)c3ccc(F)cc3S(=O)(=O)N2C)s1 |
| InChI | InChI=1S/C14H12FN3O4S2/c1-7-6-16-14(23-7)17-13(20)11-12(19)9-4-3-8(15)5-10(9)24(21,22)18(11)2/h3-6,11H,1-2H3,(H,16,17,20) |
| InChIKey | NVRIURGDOZOVNN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|