C15H15Cl2NO3 — CID 54101797
methyl 5-(2,6-dichlorophenyl)-2-(ethyliminomethyl)-3-oxopent-4-enoate (PubChem CID 54101797) has the molecular formula C15H15Cl2NO3 and a molecular weight of 328.20 g/mol. Its IUPAC name is methyl 5-(2,6-dichlorophenyl)-2-(ethyliminomethyl)-3-oxopent-4-enoate.
| Compound Name | methyl 5-(2,6-dichlorophenyl)-2-(ethyliminomethyl)-3-oxopent-4-enoate |
|---|---|
| PubChem CID | 54101797 |
| Molecular Formula | C15H15Cl2NO3 |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | methyl 5-(2,6-dichlorophenyl)-2-(ethyliminomethyl)-3-oxopent-4-enoate |
| SMILES | CC/N=C/C(C(=O)C=Cc1c(Cl)cccc1Cl)C(=O)OC |
| InChI | InChI=1S/C15H15Cl2NO3/c1-3-18-9-11(15(20)21-2)14(19)8-7-10-12(16)5-4-6-13(10)17/h4-9,11H,3H2,1-2H3/b8-7?,18-9+ |
| InChIKey | NAZMFZFIXFWBBA-VDWAPFSXSA-N |
| XLogP | 3.46 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|