C18H24N2O3 — CID 54214203
methyl 5-[4-(dimethylamino)-3-methylphenyl]-2-(ethyliminomethyl)-3-oxopent-4-enoate (PubChem CID 54214203) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is methyl 5-[4-(dimethylamino)-3-methylphenyl]-2-(ethyliminomethyl)-3-oxopent-4-enoate.
| Compound Name | methyl 5-[4-(dimethylamino)-3-methylphenyl]-2-(ethyliminomethyl)-3-oxopent-4-enoate |
|---|---|
| PubChem CID | 54214203 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | methyl 5-[4-(dimethylamino)-3-methylphenyl]-2-(ethyliminomethyl)-3-oxopent-4-enoate |
| SMILES | CC/N=C/C(C(=O)C=Cc1ccc(N(C)C)c(C)c1)C(=O)OC |
| InChI | InChI=1S/C18H24N2O3/c1-6-19-12-15(18(22)23-5)17(21)10-8-14-7-9-16(20(3)4)13(2)11-14/h7-12,15H,6H2,1-5H3/b10-8?,19-12+ |
| InChIKey | PXZUURSOMCCTIG-JDNJLSNDSA-N |
| XLogP | 2.52 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|