C22H27N8O5S2+ — CID 54102220
(6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-propoxyiminoacetyl]amino]-3-[[3-(ethylamino)pyrazin-1-ium-1-yl]methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 54102220) has the molecular formula C22H27N8O5S2+ and a molecular weight of 547.64 g/mol. Its IUPAC name is (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-propoxyiminoacetyl]amino]-3-[[3-(ethylamino)pyrazin-1-ium-1-yl]methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-propoxyiminoacetyl]amino]-3-[[3-(ethylamino)pyrazin-1-ium-1-yl]methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 54102220 |
| Molecular Formula | C22H27N8O5S2+ |
| Molecular Weight | 547.64 g/mol |
| Exact Mass | 547.15 |
| IUPAC Name | (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-propoxyiminoacetyl]amino]-3-[[3-(ethylamino)pyrazin-1-ium-1-yl]methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CCCON=C(C(=O)NC1C(=O)N2C(C(=O)O)=C(C[n+]3ccnc(NCC)c3)CS[C@@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C22H26N8O5S2/c1-3-7-35-28-15(13-11-37-22(23)26-13)18(31)27-16-19(32)30-17(21(33)34)12(10-36-20(16)30)8-29-6-5-25-14(9-29)24-4-2/h5-6,9,11,16,20H,3-4,7-8,10H2,1-2H3,(H4-,23,24,25,26,27,31,33,34)/p+1/t16?,20-/m0/s1 |
| InChIKey | NBHBWYHVBMKNRF-FZCLLLDFSA-O |
| XLogP | 0.41 |
| TPSA | 176.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.64 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|