C22H20N2O5S — CID 54102589
phenyl 4-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]piperidine-1-carboxylate (PubChem CID 54102589) has the molecular formula C22H20N2O5S and a molecular weight of 424.48 g/mol. Its IUPAC name is phenyl 4-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]piperidine-1-carboxylate.
| Compound Name | phenyl 4-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 54102589 |
| Molecular Formula | C22H20N2O5S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | phenyl 4-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]piperidine-1-carboxylate |
| SMILES | O=C1NC(=O)C(=Cc2ccc(OC3CCN(C(=O)Oc4ccccc4)CC3)cc2)S1 |
| InChI | InChI=1S/C22H20N2O5S/c25-20-19(30-21(26)23-20)14-15-6-8-17(9-7-15)28-18-10-12-24(13-11-18)22(27)29-16-4-2-1-3-5-16/h1-9,14,18H,10-13H2,(H,23,25,26) |
| InChIKey | NBNVREXWUYEERD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|