C20H17N3O4S — CID 11610926
[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] (2S)-1-pyridin-2-ylpyrrolidine-2-carboxylate (PubChem CID 11610926) has the molecular formula C20H17N3O4S and a molecular weight of 395.44 g/mol. Its IUPAC name is [4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] (2S)-1-pyridin-2-ylpyrrolidine-2-carboxylate.
| Compound Name | [4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] (2S)-1-pyridin-2-ylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 11610926 |
| Molecular Formula | C20H17N3O4S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | [4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] (2S)-1-pyridin-2-ylpyrrolidine-2-carboxylate |
| SMILES | O=C1NC(=O)/C(=C/c2ccc(OC(=O)[C@@H]3CCCN3c3ccccn3)cc2)S1 |
| InChI | InChI=1S/C20H17N3O4S/c24-18-16(28-20(26)22-18)12-13-6-8-14(9-7-13)27-19(25)15-4-3-11-23(15)17-5-1-2-10-21-17/h1-2,5-10,12,15H,3-4,11H2,(H,22,24,26)/b16-12-/t15-/m0/s1 |
| InChIKey | WBDUXYUIROKLPJ-JORMNFRLSA-N |
| XLogP | 2.98 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|