C22H17N3O3S — CID 173307406
5-[[4-[[(2S)-1-quinolin-2-ylaziridin-2-yl]methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 173307406) has the molecular formula C22H17N3O3S and a molecular weight of 403.46 g/mol. Its IUPAC name is 5-[[4-[[(2S)-1-quinolin-2-ylaziridin-2-yl]methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[[(2S)-1-quinolin-2-ylaziridin-2-yl]methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 173307406 |
| Molecular Formula | C22H17N3O3S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 5-[[4-[[(2S)-1-quinolin-2-ylaziridin-2-yl]methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(=Cc2ccc(OC[C@@H]3CN3c3ccc4ccccc4n3)cc2)S1 |
| InChI | InChI=1S/C22H17N3O3S/c26-21-19(29-22(27)24-21)11-14-5-8-17(9-6-14)28-13-16-12-25(16)20-10-7-15-3-1-2-4-18(15)23-20/h1-11,16H,12-13H2,(H,24,26,27)/t16-,25?/m0/s1 |
| InChIKey | BRVSGEWKCSHWRG-YPHZTSLFSA-N |
| XLogP | 3.83 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|