C15H13NO3S2 — CID 89042691
(5Z)-5-[[4-(2,3-dihydrothiophen-3-ylmethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 89042691) has the molecular formula C15H13NO3S2 and a molecular weight of 319.41 g/mol. Its IUPAC name is (5Z)-5-[[4-(2,3-dihydrothiophen-3-ylmethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-(2,3-dihydrothiophen-3-ylmethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 89042691 |
| Molecular Formula | C15H13NO3S2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | (5Z)-5-[[4-(2,3-dihydrothiophen-3-ylmethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2ccc(OCC3C=CSC3)cc2)S1 |
| InChI | InChI=1S/C15H13NO3S2/c17-14-13(21-15(18)16-14)7-10-1-3-12(4-2-10)19-8-11-5-6-20-9-11/h1-7,11H,8-9H2,(H,16,17,18)/b13-7- |
| InChIKey | YBOWCRSTQNRUOM-QPEQYQDCSA-N |
| XLogP | 3.27 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|