C10H19O4PS3 — CID 54105895
1-S,4-S-diethyl 2-dimethoxyphosphinothioylbutanebis(thioate) (PubChem CID 54105895) has the molecular formula C10H19O4PS3 and a molecular weight of 330.43 g/mol. Its IUPAC name is 1-S,4-S-diethyl 2-dimethoxyphosphinothioylbutanebis(thioate).
| Compound Name | 1-S,4-S-diethyl 2-dimethoxyphosphinothioylbutanebis(thioate) |
|---|---|
| PubChem CID | 54105895 |
| Molecular Formula | C10H19O4PS3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | 1-S,4-S-diethyl 2-dimethoxyphosphinothioylbutanebis(thioate) |
| SMILES | CCSC(=O)CC(C(=O)SCC)P(=S)(OC)OC |
| InChI | InChI=1S/C10H19O4PS3/c1-5-17-9(11)7-8(10(12)18-6-2)15(16,13-3)14-4/h8H,5-7H2,1-4H3 |
| InChIKey | NDSUDYVDPAAYTF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|