C16H14F2N2O5S — CID 54106004
3,4-difluoro-N-[(6R,7R)-6-hydroxy-5,5-dimethyl-2-nitro-6,7-dihydrothieno[3,2-b]pyran-7-yl]benzamide (PubChem CID 54106004) has the molecular formula C16H14F2N2O5S and a molecular weight of 384.36 g/mol. Its IUPAC name is 3,4-difluoro-N-[(6R,7R)-6-hydroxy-5,5-dimethyl-2-nitro-6,7-dihydrothieno[3,2-b]pyran-7-yl]benzamide.
| Compound Name | 3,4-difluoro-N-[(6R,7R)-6-hydroxy-5,5-dimethyl-2-nitro-6,7-dihydrothieno[3,2-b]pyran-7-yl]benzamide |
|---|---|
| PubChem CID | 54106004 |
| Molecular Formula | C16H14F2N2O5S |
| Molecular Weight | 384.36 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | 3,4-difluoro-N-[(6R,7R)-6-hydroxy-5,5-dimethyl-2-nitro-6,7-dihydrothieno[3,2-b]pyran-7-yl]benzamide |
| SMILES | CC1(C)Oc2cc([N+](=O)[O-])sc2[C@H](NC(=O)c2ccc(F)c(F)c2)[C@H]1O |
| InChI | InChI=1S/C16H14F2N2O5S/c1-16(2)14(21)12(13-10(25-16)6-11(26-13)20(23)24)19-15(22)7-3-4-8(17)9(18)5-7/h3-6,12,14,21H,1-2H3,(H,19,22)/t12-,14+/m0/s1 |
| InChIKey | NDUUXDZASFBTDE-GXTWGEPZSA-N |
| XLogP | 2.94 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.36 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|