C21H34BrNO4 — CID 54107649
tert-butyl N-[1-[4-(4-bromobut-2-enyl)-5-oxooxolan-2-yl]-2-cyclohexylethyl]carbamate (PubChem CID 54107649) has the molecular formula C21H34BrNO4 and a molecular weight of 444.41 g/mol. Its IUPAC name is tert-butyl N-[1-[4-(4-bromobut-2-enyl)-5-oxooxolan-2-yl]-2-cyclohexylethyl]carbamate.
| Compound Name | tert-butyl N-[1-[4-(4-bromobut-2-enyl)-5-oxooxolan-2-yl]-2-cyclohexylethyl]carbamate |
|---|---|
| PubChem CID | 54107649 |
| Molecular Formula | C21H34BrNO4 |
| Molecular Weight | 444.41 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | tert-butyl N-[1-[4-(4-bromobut-2-enyl)-5-oxooxolan-2-yl]-2-cyclohexylethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CC1CCCCC1)C1CC(CC=CCBr)C(=O)O1 |
| InChI | InChI=1S/C21H34BrNO4/c1-21(2,3)27-20(25)23-17(13-15-9-5-4-6-10-15)18-14-16(19(24)26-18)11-7-8-12-22/h7-8,15-18H,4-6,9-14H2,1-3H3,(H,23,25) |
| InChIKey | NEWSFPKVNPLVAF-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.41 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|