C26H33NO3 — CID 54108332
(2S)-2-[2-cyclohexylethyl-(3,5-dimethylbenzoyl)amino]-3-phenylpropanoic acid (PubChem CID 54108332) has the molecular formula C26H33NO3 and a molecular weight of 407.55 g/mol. Its IUPAC name is (2S)-2-[2-cyclohexylethyl-(3,5-dimethylbenzoyl)amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[2-cyclohexylethyl-(3,5-dimethylbenzoyl)amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 54108332 |
| Molecular Formula | C26H33NO3 |
| Molecular Weight | 407.55 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | (2S)-2-[2-cyclohexylethyl-(3,5-dimethylbenzoyl)amino]-3-phenylpropanoic acid |
| SMILES | Cc1cc(C)cc(C(=O)N(CCC2CCCCC2)[C@@H](Cc2ccccc2)C(=O)O)c1 |
| InChI | InChI=1S/C26H33NO3/c1-19-15-20(2)17-23(16-19)25(28)27(14-13-21-9-5-3-6-10-21)24(26(29)30)18-22-11-7-4-8-12-22/h4,7-8,11-12,15-17,21,24H,3,5-6,9-10,13-14,18H2,1-2H3,(H,29,30)/t24-/m0/s1 |
| InChIKey | NFHZLVGMOJLBEP-DEOSSOPVSA-N |
| XLogP | 5.41 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.55 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |