C19H23NO2 — CID 18663405
N-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-N,3,5-trimethylbenzamide (PubChem CID 18663405) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is N-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-N,3,5-trimethylbenzamide.
| Compound Name | N-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-N,3,5-trimethylbenzamide |
|---|---|
| PubChem CID | 18663405 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | N-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-N,3,5-trimethylbenzamide |
| SMILES | Cc1cc(C)cc(C(=O)N(C)[C@@H](CO)Cc2ccccc2)c1 |
| InChI | InChI=1S/C19H23NO2/c1-14-9-15(2)11-17(10-14)19(22)20(3)18(13-21)12-16-7-5-4-6-8-16/h4-11,18,21H,12-13H2,1-3H3/t18-/m1/s1 |
| InChIKey | QCWBXJZZFNIVQX-GOSISDBHSA-N |
| XLogP | 2.98 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |