C9H5F3O4 — CID 54108772
3-(2,2,2-trifluoroacetyl)oxybenzoic acid (PubChem CID 54108772) has the molecular formula C9H5F3O4 and a molecular weight of 234.13 g/mol. Its IUPAC name is 3-(2,2,2-trifluoroacetyl)oxybenzoic acid.
| Compound Name | 3-(2,2,2-trifluoroacetyl)oxybenzoic acid |
|---|---|
| PubChem CID | 54108772 |
| Molecular Formula | C9H5F3O4 |
| Molecular Weight | 234.13 g/mol |
| Exact Mass | 234.01 |
| IUPAC Name | 3-(2,2,2-trifluoroacetyl)oxybenzoic acid |
| SMILES | O=C(O)c1cccc(OC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C9H5F3O4/c10-9(11,12)8(15)16-6-3-1-2-5(4-6)7(13)14/h1-4H,(H,13,14) |
| InChIKey | NFPLYVXJTDHGFA-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.13 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|